2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide manufacturers
- TMN355
-
- $35.00
-
2026-05-11
- CAS:1186372-20-2
- Purity: 99.15%
- Supply Ability: 10g
- TMN355
-
- $35.00
-
2026-04-22
- CAS:1186372-20-2
- Purity: 99.15%
- Supply Ability: 10g
|
| | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide Basic information |
| Product Name: | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide | | Synonyms: | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide;Benzamide, 2-chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluoro-;1-(2-Chloro-6-fluorobenzoyl)-3-(9H-fluoren-9-yl)urea;TMN-355,Inhibitor,TMN 355,inhibit,TMN355;TMN355, 10 mM in DMSO;Cyclophilin A Inhibitor;TMN 355 | | CAS: | 1186372-20-2 | | MF: | C21H14ClFN2O2 | | MW: | 380.8 | | EINECS: | | | Product Categories: | | | Mol File: | 1186372-20-2.mol | ![2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide Structure](CAS/GIF/1186372-20-2.gif) |
| | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide Chemical Properties |
| Melting point | 242-245℃ | | density | 1.43 | | storage temp. | Store at RT | | solubility | DMSO: 40 mM | | form | A solid | | pka | 9.13±0.46(Predicted) | | color | White to yellow | | InChI | 1S/C21H14ClFN2O2/c22-16-10-5-11-17(23)18(16)20(26)25-21(27)24-19-14-8-3-1-6-12(14)13-7-2-4-9-15(13)19/h1-11,19H,(H2,24,25,26,27) | | InChIKey | SFNLLCUAISZNRV-UHFFFAOYSA-N | | SMILES | Fc1c(c(ccc1)Cl)C(=O)NC(=O)NC2c3c(cccc3)c4c2cccc4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide Usage And Synthesis |
| Uses | TMN 355 is a potent small molecule inhibitor of cyclophilin A. | | IC 50 | Cyclophilin A |
| | 2-Chloro-N-[(9H-fluoren-9-ylamino)carbonyl]-6-fluorobenzamide Preparation Products And Raw materials |
|