- 4-Fluoroacetanilide
-
- $13.00 / 1Kg/Bag
-
2020-11-16
- CAS:103724-99-8
- Min. Order: 25Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
|
| | 4-Chloro-2,6-diMethylbroMo benzene Basic information |
| Product Name: | 4-Chloro-2,6-diMethylbroMo benzene | | Synonyms: | 4-Chloro-2,6-diMethylbroMo benzene;2-BroMo-5-chloro-1,3-diMethylbebzene;4-Chloro-2,6-dimethylphenyl bromide;4-Chloro-2,6-diMethylbroMobenzene[2-BroMo-5-chloro-1,3-diMethylbenzene];2-Bromo-5-chloro-1,3-dimethylbenzene;Benzene, 2-bromo-5-chloro-1,3-dimethyl-;6-diMethylbroMo benzene;2-Bromo-5-chloro-3-methyl-toluene | | CAS: | 103724-99-8 | | MF: | C8H8BrCl | | MW: | 219.51 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 103724-99-8.mol |  |
| | 4-Chloro-2,6-diMethylbroMo benzene Chemical Properties |
| Melting point | 22-23℃ | | Boiling point | 243.5℃ | | density | 1.462 | | Fp | 119.9℃ | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, light lime/lemon | | InChI | InChI=1S/C8H8BrCl/c1-5-3-7(10)4-6(2)8(5)9/h3-4H,1-2H3 | | InChIKey | CFMPIQSLDJXNPD-UHFFFAOYSA-N | | SMILES | C1(C)=CC(Cl)=CC(C)=C1Br |
| | 4-Chloro-2,6-diMethylbroMo benzene Usage And Synthesis |
| Synthesis Reference(s) | Synthesis, p. 647, 1985 DOI: 10.1055/s-1985-31292 | | Synthesis | General procedure for the synthesis of 4-chloro-2,6-dimethylbromobenzene from 4-chloro-2,6-dimethylaniline: the procedure was carried out according to Example 1, with the difference that only 6.95 g (0.025 mol) of FeSO4-7H2O was used.At the end of the reaction 20.7 g of oily product was obtained. The content of 4-chloro-2,6-dimethylbromobenzene in the product was analyzed by gas chromatography (GC) to be 97.1% and the yield was 91% of the theoretical value. | | References | [1] Patent: US2010/234652, 2010, A1. Location in patent: Page/Page column 4 |
| | 4-Chloro-2,6-diMethylbroMo benzene Preparation Products And Raw materials |
|