| Company Name: |
Suzhou Sino Rare Chemical Co., Ltd.
|
| Tel: |
0512-62857507 |
| Email: |
sales@sinorarechem.com |
| Products Intro: |
Product Name:1,5-Difluoro-2,4-dimethoxybenzene CAS:79069-70-8 Purity:98% Package:25KG;5KG;1KG
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:1,3-Difluoro-4,6-dimethoxybenzene CAS:79069-70-8 Purity:95+% Package:1g;5g;10g
|
|
| | 1,5-Difluoro-2,4-dimethoxybenzene Basic information |
| Product Name: | 1,5-Difluoro-2,4-dimethoxybenzene | | Synonyms: | 1,5-Difluoro-2,4-dimethoxybenzene;4,6-Difluororesorcinol dimethyl ether;Benzene, 1,5-difluoro-2,4-dimethoxy-;1,3-Difluoro-4,6-dimethoxybenzene;2,4-difluoro-1,5-dimethoxybenzene;1,5-difluoro-2,4-dimethoxybenzene - [AC80514] | | CAS: | 79069-70-8 | | MF: | C8H8F2O2 | | MW: | 174.14 | | EINECS: | | | Product Categories: | | | Mol File: | 79069-70-8.mol |  |
| | 1,5-Difluoro-2,4-dimethoxybenzene Chemical Properties |
| Melting point | 99 °C | | Boiling point | 230.2±35.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H8F2O2/c1-11-7-4-8(12-2)6(10)3-5(7)9/h3-4H,1-2H3 | | InChIKey | INATUVGKCBFRFJ-UHFFFAOYSA-N | | SMILES | C1(F)=CC(F)=C(OC)C=C1OC |
| | 1,5-Difluoro-2,4-dimethoxybenzene Usage And Synthesis |
| | 1,5-Difluoro-2,4-dimethoxybenzene Preparation Products And Raw materials |
|