| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Valaciclovir iMpurity D Basic information |
| Product Name: | Valaciclovir iMpurity D | | Synonyms: | 2-[(2-amino-6-oxo-3H-purin-9-yl)methoxy]ethyl (2S)-2-(ethylamino)-3-methylbutanoate;Valacyclovir Impurity D( EP);Valaciclovir iMpurity D;2-[(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl N-ethyl-L-valinate;N-Ethyl-L-valine 2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester;Valaciclovir impurity D (PhEur);Valaciclovir Related Compound D (USP);Valaciclovir EP Impurity D | | CAS: | 1346747-69-0 | | MF: | C15H24N6O4 | | MW: | 352.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1346747-69-0.mol |  |
| | Valaciclovir iMpurity D Chemical Properties |
| Boiling point | 591.7±60.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 7.82±0.19(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H24N6O4/c1-4-17-10(9(2)3)14(23)25-6-5-24-8-21-7-18-11-12(21)19-15(16)20-13(11)22/h7,9-10,17H,4-6,8H2,1-3H3,(H3,16,19,20,22)/t10-/m0/s1 | | InChIKey | OKUHBUGXDSIJIM-JTQLQIEISA-N | | SMILES | [n]1(c2nc(nc(c2nc1)O)N)COCCOC(=O)[C@@H](NCC)C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Valaciclovir iMpurity D Usage And Synthesis |
| Uses | Valaciclovir iMpurity D, whose chemical name is 2-[(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl-N-ethyl-L-valinate, is a drug impurity of Valaciclovir and can be used as an analytical standard. |
| | Valaciclovir iMpurity D Preparation Products And Raw materials |
|