|
|
| | PotassiuM Azeloycinate Diglycinate Basic information |
| Product Name: | PotassiuM Azeloycinate Diglycinate | | Synonyms: | PotassiuM Azeloycinate Diglycinate;Glycine,N,N'-(1,9-dioxo-1,9-nonanediyl)bis-, potassiuM salt (1:1);Azeloglicina;N,N'-(1,9-Dioxo-1,9-nonanediyl)bisglycine monopotassium salt;Postassium azeloyl diglycinate;TIANFU CHEM----PotassiuM Azeloycinate Diglycinate;Azelaic acid amino acid potassium salt;PotassiuM Azeloycinate Diglycinat | | CAS: | 477773-67-4 | | MF: | C13H23KN2O6 | | MW: | 342.43 | | EINECS: | 686-756-8 | | Product Categories: | | | Mol File: | 477773-67-4.mol |  |
| | PotassiuM Azeloycinate Diglycinate Chemical Properties |
| Odor | Almost odorless | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C13H22N2O6.K.H/c16-10(14-8-12(18)19)6-4-2-1-3-5-7-11(17)15-9-13(20)21;;/h1-9H2,(H,14,16)(H,15,17)(H,18,19)(H,20,21);; | | InChIKey | UNWKZRHPXZYOAO-UHFFFAOYSA-N | | SMILES | C(=O)(CCCCCCCC(=O)NCC(=O)O)NCC(=O)O.[KH] |
| | PotassiuM Azeloycinate Diglycinate Usage And Synthesis |
| Uses |
PotassiuM Azeloycinate Diglycinate is a whitening and acne-removing raw material. However, its application is greatly limited due to its water insolubility, high melting point, large dosage, easy discoloration, and poor compatibility. PotassiuM Azeloycinate Diglycinate is a newly developed azelaic acid derivative. It is soluble in water and used in small amounts. It has good effects on regulating oil secretion and has a stronger whitening effect.
|
| | PotassiuM Azeloycinate Diglycinate Preparation Products And Raw materials |
|