| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Epalrestat Impurity 2 CAS:23176-01-4 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | 3-Thiazolidineaceticacid, 4-oxo-2-thioxo-, ethyl ester Basic information |
| | 3-Thiazolidineaceticacid, 4-oxo-2-thioxo-, ethyl ester Chemical Properties |
| Boiling point | 315.5±44.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | pka | -2.14±0.20(Predicted) | | InChI | InChI=1S/C7H9NO3S2/c1-2-11-6(10)3-8-5(9)4-13-7(8)12/h2-4H2,1H3 | | InChIKey | QDRLGCJQLOXVLY-UHFFFAOYSA-N | | SMILES | S1CC(=O)N(CC(OCC)=O)C1=S |
| | 3-Thiazolidineaceticacid, 4-oxo-2-thioxo-, ethyl ester Usage And Synthesis |
| | 3-Thiazolidineaceticacid, 4-oxo-2-thioxo-, ethyl ester Preparation Products And Raw materials |
|