|
|
| | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid Basic information |
| Product Name: | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid | | Synonyms: | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid;Eltrombopag olamine Intermediate 3;2'-Methoxy-3'-nitro-3-biphenylcarboxylic acid;Eltrombopag Impurity 20;[1,1'-Biphenyl]-3-carboxylic acid, 2'-methoxy-3'-nitro-;Eltrombopag Impurity 45;Eltrombopag Olamine Impurity 4;Eltrombopag Impurity 141 | | CAS: | 376591-94-5 | | MF: | C14H11NO5 | | MW: | 273.24 | | EINECS: | | | Product Categories: | | | Mol File: | 376591-94-5.mol |  |
| | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid Chemical Properties |
| Boiling point | 467.2±40.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | pka | 3.95±0.10(Predicted) | | InChI | InChI=1S/C14H11NO5/c1-20-13-11(6-3-7-12(13)15(18)19)9-4-2-5-10(8-9)14(16)17/h2-8H,1H3,(H,16,17) | | InChIKey | AAPGMCIBKOSNAL-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC([N+]([O-])=O)=C2OC)=CC=CC(C(O)=O)=C1 |
| | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid Usage And Synthesis |
| Uses | 2''-Methoxy-3''-nitro-[1,1''-biphenyl]-3-carboxylic Acid is a reagent which can be used for preparation of pyrazolone derivatives useful in thrombocytopenia treatment |
| | 2'-Methoxy-3'-nitro-biphenyl-3-carboxylic acid Preparation Products And Raw materials |
|