|
|
| | Z-LYS(Z)-OSU Basic information |
| Product Name: | Z-LYS(Z)-OSU | | Synonyms: | Z-LYS(Z)-OSU;Z-LYSINE(Z)-OSU;Z-LYS-OSU;na,N-epsilon-di-cbz-L-lysine N-*hydroxysuccinimid;nα,nε-di-z-l-lysine hydroxysuccinimide ester;Z-LYL(Z)-OSU;[(S)-1-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-1,5-pentanediyl]bis(carbamic acid benzyl) ester;N-ALPHA,N-EPSILON-DI-Z-L-LYSINE HYDROXYSUCCINIMIDE ESTER | | CAS: | 21160-83-8 | | MF: | C26H29N3O8 | | MW: | 511.52 | | EINECS: | | | Product Categories: | | | Mol File: | 21160-83-8.mol |  |
| | Z-LYS(Z)-OSU Chemical Properties |
| Melting point | 112-113 °C(Solv: ethyl acetate (141-78-6); ligroine (8032-32-4)) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Dioxane (Slightly), Methanol (Slightly, Sonicated), Wate | | pka | 10.55±0.46(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 1559792 | | Major Application | peptide synthesis | | InChIKey | LHOAUCZIIQFZMI-NRFANRHFSA-N | | SMILES | O=C(NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)ON2C(=O)CCC2=O)OCc3ccccc3 |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | Z-LYS(Z)-OSU Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-LYS(Z)-OSU Preparation Products And Raw materials |
|