| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester Basic information |
| Product Name: | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester | | Synonyms: | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester;Tert-Butyl N-(1,3-Thiazol-2-Ylmethyl)Carbamate;Tert-Butyl N-(1,3-Thiazol-2-Ylmethyl)Carbamate(WX619150);Carbamic acid, N-(2-thiazolylmethyl)-, 1,1-dimethylethyl ester;tert-butyl (thiazol-2-ylmethyl)carbamate | | CAS: | 185747-16-4 | | MF: | C9H14N2O2S | | MW: | 214.28 | | EINECS: | | | Product Categories: | | | Mol File: | 185747-16-4.mol |  |
| | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester Chemical Properties |
| InChI | InChI=1S/C9H14N2O2S/c1-9(2,3)13-8(12)11-6-7-10-4-5-14-7/h4-5H,6H2,1-3H3,(H,11,12) | | InChIKey | LPVMUQICXQOGRE-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCC1=NC=CS1 |
| | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|