| Company Name: |
Hebei Suntec Gold |
| Tel: |
0311-0311-85469575 13833123611 |
| Email: |
sales@suntechem.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,2,3-Tris(2-cyanoethoxy)propane Basic information |
| Product Name: | 1,2,3-Tris(2-cyanoethoxy)propane | | Synonyms: | 3,3',3''-[1,2,3-Propanetriyltris(oxy)]tris(propanenitrile);1,2,3-Tris(2-cyanoethoxy)propane,85%,tech.;3,3’,3’’-[1,2,3-propanetriyltris(oxy)]tris-propanenitril;TIMTEC-BB SBB007767;3,3',3''-(1,2,3-PROPANETRIYLTRIOXY)TRIPROPIONITRILE;3,3',3''-(GLYCERYLTRIOXY)TRIPROPIONITRILE;3,3',3''-propane-1,2,3-triyltrioxytripropiononitrile;1,2,3-TRIS(2-CYANOETHOXY)PROPANE [LIQUID PHASE FOR ] 95+% | | CAS: | 2465-93-2 | | MF: | C12H17N3O3 | | MW: | 251.28 | | EINECS: | 219-573-5 | | Product Categories: | Dinitriles & Trinitriles;Trinitriles;Gas Chromatography;Packed GC;Stationary Phases | | Mol File: | 2465-93-2.mol |  |
| | 1,2,3-Tris(2-cyanoethoxy)propane Chemical Properties |
| Boiling point | 394.44°C (rough estimate) | | density | 1.11 | | refractive index | 1.4600 to 1.4640 | | Fp | >93.33 °C | | storage temp. | Storage temp. 2-8°C | | form | Liquid | | Specific Gravity | 1.107 | | color | White to Yellow to Green | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C12H17N3O3/c13-4-1-7-16-10-12(18-9-3-6-15)11-17-8-2-5-14/h12H,1-3,7-11H2 | | InChIKey | ALGVJKNIAOBBBJ-UHFFFAOYSA-N | | SMILES | C(OCCC#N)C(OCCC#N)COCCC#N | | CAS DataBase Reference | 2465-93-2(CAS DataBase Reference) | | EPA Substance Registry System | Propanenitrile, 3,3',3''-[1,2,3-propanetriyltris(oxy)]tris- (2465-93-2) |
| Safety Statements | 24/25 | | RIDADR | UN3276 | | TSCA | TSCA listed | | HS Code | 2926.90.5050 | | HazardClass | 6.1 | | PackingGroup | II |
| | 1,2,3-Tris(2-cyanoethoxy)propane Usage And Synthesis |
| Chemical Properties | clear colorless viscous liquid | | Uses | 1,2,3-Tris(2-cyanoethoxy)propane could be used as the stationary phase in gas-liquid chromatography. |
| | 1,2,3-Tris(2-cyanoethoxy)propane Preparation Products And Raw materials |
|