BzMIMBr manufacturers
- BzMIMBr
-
- $6.68 / 1KG
-
2020-01-10
- CAS: 65039-11-4
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | BzMIMBr Basic information |
| Product Name: | BzMIMBr | | Synonyms: | 1H-Imidazolium, 1-methyl-3-(phenylmethyl)-, bromide;1-Benzyl-3-MethylImidazolium;3-benzyl-1-methyl-1H-imidazol-3-ium bromide;BzMIMBr;1-Benzyl-3-methylIimidazolium bromide;1-Benzyl-3-methyl-1H-imidazol-3-ium bromide | | CAS: | 65039-11-4 | | MF: | C11H13BrN2 | | MW: | 253.13832 | | EINECS: | | | Product Categories: | | | Mol File: | 65039-11-4.mol |  |
| | BzMIMBr Chemical Properties |
| Melting point | 173 °C | | storage temp. | Store at room temperature, keep dry and cool | | Appearance | Colorless to light yellow Viscous Liquid | | InChI | InChI=1S/C11H13N2.BrH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;/h2-8,10H,9H2,1H3;1H/q+1;/p-1 | | InChIKey | VBLZTUCAWYJIMG-UHFFFAOYSA-M | | SMILES | C1N(CC2=CC=CC=C2)C=C[N+]=1C.[Br-] |
| | BzMIMBr Usage And Synthesis |
| | BzMIMBr Preparation Products And Raw materials |
|