| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1-Methyl-1H-pyrazol-5-yl)tributylstannane Basic information |
| Product Name: | (1-Methyl-1H-pyrazol-5-yl)tributylstannane | | Synonyms: | (1-Methyl-1H-pyrazol-5-yl)tributylstannane;Tributyl-(2-methylpyrazol-3-yl)stannane;1-Methyl-5-(tributylstannyl)-1H-pyrazole;1H-Pyrazole, 1-methyl-5-(tributylstannyl)-;1-Methyl-5-(tributylstannyl)-1H-pyrazole 97%;1-Methyl-5-(tributylstannyl)-1H-pyrazole;1-Methyl-5-(tributylstannyl)-1H-pyrazole - [M69898];1-methyl-5-(tributylmethylalkaneyl)-1H-pyridineazole | | CAS: | 170682-50-5 | | MF: | C16H32N2Sn | | MW: | 371.15 | | EINECS: | | | Product Categories: | | | Mol File: | 170682-50-5.mol |  |
| | (1-Methyl-1H-pyrazol-5-yl)tributylstannane Chemical Properties |
| Boiling point | 382.8±34.0 °C(Predicted) | | density | 1.160 g/mL at 25 °C | | Fp | >110℃ | | pka | 2.27±0.10(Predicted) | | form | liquid | | InChI | 1S/C4H5N2.3C4H9.Sn/c1-6-4-2-3-5-6;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3; | | InChIKey | MEFBHJAGBFBLEH-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccnn1C |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | (1-Methyl-1H-pyrazol-5-yl)tributylstannane Usage And Synthesis |
| | (1-Methyl-1H-pyrazol-5-yl)tributylstannane Preparation Products And Raw materials |
|