|
|
| | Bis(neopentyl glycolato)diboron Basic information |
| Product Name: | Bis(neopentyl glycolato)diboron | | Synonyms: | Bis(neopentylglycolato)diboron, min. 97%;Bis(neopentyl glycolato)diboron,98%;Bis(neopentylglycolate)diboron;Bis (neopentylglycolato) diboran;Bis(neopentylglycolato)diboron,min.97%;5,5,5',5'-TETRAMETHYL-2,2'-BI-1,3,2-DIOXABORINANE;5,5,5',5'-TETRAMETHYL-2,2'-BIS(1,3,2-DIOXABORINANE);BIS(2,2-DIMETHYL-1,3-PROPANEDIOLATO)DIBORON | | CAS: | 201733-56-4 | | MF: | C10H20B2O4 | | MW: | 225.89 | | EINECS: | 639-407-9 | | Product Categories: | Heterocycles;Miscellaneous Reagents;Boronic ester;Organoborons;B (Classes of Boron Compounds);Diboron Esters;CHIRAL CHEMICALS;Pharmaceutical Intermediates;DIBORON SERIES | | Mol File: | 201733-56-4.mol |  |
| | Bis(neopentyl glycolato)diboron Chemical Properties |
| Melting point | 180.5-184.5 °C(lit.) | | Boiling point | 214.3±7.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Liquid | | color | Clear colorless | | Sensitive | moisture sensitive | | BRN | 8839038 | | InChI | InChI=1S/C10H20B2O4/c1-9(2)5-13-11(14-6-9)12-15-7-10(3,4)8-16-12/h5-8H2,1-4H3 | | InChIKey | MDNDJMCSXOXBFZ-UHFFFAOYSA-N | | SMILES | O1CC(C)(C)COB1B1OCC(C)(C)CO1 | | CAS DataBase Reference | 201733-56-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | TSCA | N | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | Bis(neopentyl glycolato)diboron Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powder | | Uses | suzuki reaction | | Uses | Bis(neopentyl glycolato)diboron can make borate adducts used for Suzuki coupling. | | Uses | Reagent to prepare boronic acid esters. | | Synthesis | The general procedure for the synthesis of neopentyl glycol ester of biphenylboronic acid from neopentyl glycol was as follows: tetrakis(dimethylamino)diboron (9.89 g, 52.65 mmol) was slowly added to a solution of 2,2-dimethyl-1,3-propanediol (neopentyl glycol, 10.42 g, 100 mmol) in toluene (40 mL) at room temperature. The reaction mixture was then heated to 105°C, at which point dimethylamine gas began to be released. After maintaining this temperature and continuing the reaction for 60 min, the toluene solvent was removed by distillation under reduced pressure to give 11.39 g of white solid product in 95.8% yield. The crude product was purified by recrystallization from toluene to give 6.48 g of bis(neopentylglycolic acid)boron (molecular formula: C10H20B2O4; molecular weight: 225.89) in 54.5% yield. The melting point of the product was 182.5-184.5 °C. NMR hydrogen spectrum (CDCl3, 200 MHz) data: δ 0.94 (s, 12H), 3.58 (s, 6H) ppm; NMR carbon spectrum (CDCl3, 50 MHz) data: δ 22.3 (4×CH3), 31.9 (2×C), 71.7 (4×CH2) ppm. The mother liquor was retained for subsequent recrystallization. | | References | [1] Patent: WO2004/76467, 2004, A1. Location in patent: Page 15 |
| | Bis(neopentyl glycolato)diboron Preparation Products And Raw materials |
| Raw materials | 5,5-dimethyl-1,3,2-dioxaborinane-->neopentyl glycol-->TETRAKIS(DIMETHYLAMINO)DIBORON-->Toluene | | Preparation Products | 2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane-->2-(4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenyl)-1,1,1-trifluoropropan-2-ol |
|