- Folcisteine
-
-
2025-09-29
- CAS:5025-82-1
- Min. Order:
- Purity: 0.99
- Supply Ability:
- Folcisteine
-
- $0.00 / 25Kg/Drum
-
2025-09-29
- CAS:5025-82-1
- Min. Order: 1KG
- Purity: 98.5%min
- Supply Ability: 10 tons
- Folcisteine
-
- $33.00 / 1kg
-
2025-09-25
- CAS:5025-82-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Folcisteine Basic information |
| Product Name: | Folcisteine | | Synonyms: | FOLCISTEINE;3-ACETYL-4-THIAZOLIDINECARBOXYLIC ACID;3-ACETYL-THIAZOLIDIN-4-CARBOXYLIC ACID;3-ACETYL-THIAZOLIDINE-4-CARBOXYLIC ACID;Acetyl-Thiazolidine-4-Carboxylic acid;N-Acetyl-thiazolidine-4-carboxylic acid;3-Acetylthiazolidine-4-carboxylic acid(Folcisteine);3-ethanoyl-1,3-thiazolidine-4-carboxylic acid | | CAS: | 5025-82-1 | | MF: | C6H9NO3S | | MW: | 175.21 | | EINECS: | 225-713-6 | | Product Categories: | 5025-82-1 | | Mol File: | 5025-82-1.mol |  |
| | Folcisteine Chemical Properties |
| Melting point | 146-148 °C | | Boiling point | 439.0±45.0 °C(Predicted) | | density | 1.427±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C | | solubility | DMSO : ≥ 160 mg/mL (913.19 mM) | | form | Solid | | pka | 3.27±0.20(Predicted) | | color | White to off-white | | Water Solubility | 113.2g/L at 20℃ | | InChI | InChI=1S/C6H9NO3S/c1-4(8)7-3-11-2-5(7)6(9)10/h5H,2-3H2,1H3,(H,9,10) | | InChIKey | WXTBYSIPOKXCPM-UHFFFAOYSA-N | | SMILES | S1CC(C(O)=O)N(C(C)=O)C1 | | LogP | -0.5 at 25℃ | | CAS DataBase Reference | 5025-82-1(CAS DataBase Reference) | | EPA Substance Registry System | 4-Thiazolidinecarboxylic acid, 3-acetyl- (5025-82-1) |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | Folcisteine Usage And Synthesis |
| Uses | 3-Acetyl-4-thiazolidinecarboxylic acid is a reactant in the reaction of cyclic N-acyl-α-amino acids with N-(phenylmethylene)benzenesulfonamide. | | in vivo | Folcisteine has radio-protective effect when administered before radiation with 700 rads. |
| | Folcisteine Preparation Products And Raw materials |
|