- Timonacic
-
- $29.00
-
2026-05-11
- CAS:444-27-9
- Purity: 99.99%
- Supply Ability: 10g
- Timonacic
-
- $29.00
-
2026-05-11
- CAS:444-27-9
- Purity: 99.99%
- Supply Ability: 10g
|
| | Thiazolidine-4-carboxylic acid Basic information |
| | Thiazolidine-4-carboxylic acid Chemical Properties |
| Melting point | 196.5°C | | Boiling point | 350.3±37.0 °C(Predicted) | | density | 1.226 (estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | Room Temperature | | solubility | DMSO (Slightly), Water (Slightly) | | form | solid | | pka | 2.09±0.20(Predicted) | | color | White to off-white | | Water Solubility | 29.3g/L(21 ºC) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) | | InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N | | SMILES | S1CC(C(O)=O)NC1 | | CAS DataBase Reference | 444-27-9(CAS DataBase Reference) | | EPA Substance Registry System | 4-Thiazolidinecarboxylic acid (444-27-9) |
| RIDADR | 2811 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Thiazolidine-4-carboxylic acid Usage And Synthesis |
| Originator | Hepaldine,Riker,France,1964 | | Uses | hepatoprotectant | | Uses | Timonacic is a derivative of Proline (P756050), a cyclic nonessential amino acid. Timonacic is a research molecule of interest with potential antineoplastic activities by acting on the cell membrane of tumour cells and causing reverse transformation to normal cells. | | Definition | ChEBI: A sulfur-containing amino acid that is proline in which the methylene group at position 4 is replaced by a sulfur atom. | | Manufacturing Process | Cysteine is first dissolved in distilled water which has been freed of oxygen by
boiling. Formaldehyde of 30% (w/v) concentration is added while stirring and
the temperature of the mixture rises, while the thiazolidine carboxylic acid
begins crystallizing. The stirring is continued for 2 hours after which ethyl
alcohol of 95% (w/v) concentration is added to induce further crystallization.
The mixture is left to stand for 24 hours at 4°C. The mixture is then filtered
with retention of a crude product, which is purified by recrystallization from
boiling distilled water. The crystals are then dried at about 40°C. The free acid
is then converted to the sodium salt with NaOH. | | Therapeutic Function | Hepatoprotectant, Choleretic |
| | Thiazolidine-4-carboxylic acid Preparation Products And Raw materials |
|