| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-ASPARAGINE-13C4,15N2,D8 Basic information |
| | L-ASPARAGINE-13C4,15N2,D8 Chemical Properties |
| Melting point | 232 °C (dec.) (lit.) | | form | Solid | | color | White to off-white | | InChI | 1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1/i1+1D2,2+1D,3+1,4+1,5+1,6+1/hD5 | | InChIKey | DCXYFEDJOCDNAF-PYHFAUOHSA-N | | SMILES | [2H]O[13C](=O)[13C@@]([2H])([15N]([2H])[2H])[13C]([2H])([2H])[13C](=O)[15N]([2H])[2H] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-ASPARAGINE-13C4,15N2,D8 Usage And Synthesis |
| Uses | L-Asparagine-13C4,15N2,d8 is the 13C-labeled and 15N-labeled L-Asparagine. L-Asparagine ((-)-Asparagine) is a non-essential amino acid that is involved in the metabolic control of cell functions in nerve and brain tissue. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-ASPARAGINE-13C4,15N2,D8 Preparation Products And Raw materials |
|