3-(Bromomethyl)-5-methylisoxazole manufacturers
|
| | 3-(Bromomethyl)-5-methylisoxazole Basic information |
| | 3-(Bromomethyl)-5-methylisoxazole Chemical Properties |
| Boiling point | 44°C (0.4 mmHg) | | density | 1.582±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | pka | -3.41±0.12(Predicted) | | color | Clear, light yellow | | InChI | InChI=1S/C5H6BrNO/c1-4-2-5(3-6)7-8-4/h2H,3H2,1H3 | | InChIKey | ASGJFGPILHALRC-UHFFFAOYSA-N | | SMILES | O1C(C)=CC(CBr)=N1 |
| Hazard Codes | C,Xn | | Risk Statements | 34-36-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3265 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 3-(Bromomethyl)-5-methylisoxazole Usage And Synthesis |
| | 3-(Bromomethyl)-5-methylisoxazole Preparation Products And Raw materials |
|