|
|
| | 5-[3,5-Dimethoxy-4-(Fmoc-aminomethyl)phenoxy]pentanoic acid Basic information |
| | 5-[3,5-Dimethoxy-4-(Fmoc-aminomethyl)phenoxy]pentanoic acid Chemical Properties |
| Melting point | 178-180℃ | | Boiling point | 733.0±60.0 °C(Predicted) | | density | 1.238 | | storage temp. | 2-8°C | | pka | 4.67±0.10(Predicted) | | form | solid | | Appearance | White to light yellow Solid | | Major Application | peptide synthesis | | InChIKey | ATYUCXIJDKHOPX-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCOC1=CC(OC)=C(CNC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C(OC)=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-[3,5-Dimethoxy-4-(Fmoc-aminomethyl)phenoxy]pentanoic acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | It is a reagent for the mild solid-phase synthesis of C-terminal peptide amides. | | Uses | Used in the solid-phase peptide synthesis (SPPS). | | reaction suitability | reagent type: linker |
| | 5-[3,5-Dimethoxy-4-(Fmoc-aminomethyl)phenoxy]pentanoic acid Preparation Products And Raw materials |
|