DBCO-maleimide manufacturers
- DBCO-Maleimide
-
- $106.00 / 10mg
-
2026-03-04
- CAS:1395786-30-7
- Min. Order:
- Purity: 97.01%
- Supply Ability: 10g
- DBCO-Maleimide
-
- $0.00 / 25mg
-
2025-06-07
- CAS:1395786-30-7
- Min. Order: 25mg
- Purity: >98.00%
- Supply Ability: 250
|
| | DBCO-maleimide Basic information |
| Product Name: | DBCO-maleimide | | Synonyms: | DBCO-maleimide;Dibenzocyclooctyne-maleimide;Dibenzocyclooctyne-maleimide (This product is unavailable in the U.S.);1H-Pyrrole-1-propanamide, N-[3-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl]-2,5-dihydro-2,5-dioxo-;DBCO-Maleimide,Dibenzocyclooctyne-maleimide;DBCO-maleimide (This product is unavailable in the U.S.);DBCO-maleimide (This product is unavailable in the U.S.) (2mg*5);N-[3-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-3-oxopropyl]-3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamide | | CAS: | 1395786-30-7 | | MF: | C25H21N3O4 | | MW: | 427.45 | | EINECS: | | | Product Categories: | ADC LINKER | | Mol File: | 1395786-30-7.mol |  |
| | DBCO-maleimide Chemical Properties |
| Melting point | 162 °C | | Boiling point | 790.5±60.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | Solid | | pka | 15.03±0.46(Predicted) | | color | Off-white to Gray | | Appearance | Light grey solid | | InChI | 1S/C25H21N3O4/c29-22(14-16-27-23(30)11-12-24(27)31)26-15-13-25(32)28-17-20-7-2-1-5-18(20)9-10-19-6-3-4-8-21(19)28/h1-8,11-12H,13-17H2,(H,26,29) | | InChIKey | NHFQNAGPXIVKND-UHFFFAOYSA-N | | SMILES | O=C(N1CCC(NCCC(N2CC3=C(C=CC=C3)C#CC4=C2C=CC=C4)=O)=O)C=CC1=O |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | DBCO-maleimide Usage And Synthesis |
| Description | DBCO-Maleimide is a sulfhydryl reactive reagent containing a maleimide group and a DBCO moiety. Maleimide group specifically and efficiently reacts with thiols to form thioether bonds. The low mass weight will add minimal spacer to modified molecules and will enable simple and efficient incorporation of DBCO moiety into cysteine-containing peptides or other thiol-containing biomolecules. DBCO is commonly used for copper-free Click Chemistry reactions. | | Uses | Maleimide functionalized cyclooctyne derivative for incorporation of the cyclooctyne moiety into thiol containing compounds or biomolecules. Cyclooctynes are useful in strain-promoted copper-free azide-alkyne cycloaddition reactions. This dibenzocyclooctyne will react with azide functionalized compounds or biomolecules without the need for a Cu(I) catalyst to result in a stable triazole linkage.
Applications Include:
- Protein-peptide conjugates
- Antibody-enzyme or antibody-drug conjugates
- Protein or peptide-oligonucleotide conjugates
- Surface modification
| | Uses | Dbco-Maleimide is used in preparation of radioactive metal indicator-chelating peptide derivative-conjugated antibodies for medical imaging. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Non-cleavable Linker |
| | DBCO-maleimide Preparation Products And Raw materials |
|