|
|
| | Dicyclohexyl(trifluoromethanesulfonyloxy)borane Basic information |
| Product Name: | Dicyclohexyl(trifluoromethanesulfonyloxy)borane | | Synonyms: | dicyclohexyl-(trifluoromethylsulfonyloxy)borane;TRIFLUOROMETHANESULFONIC ACID DICYCLOHEXYLBORYL ESTER;DICYCLOHEXYLBORON TRIFLATE;Dicyclohexylborontrifluoromethanesulfonate;Dicyclohexylboron trifluoromethanesulfonate 97%;Dicyclohexylboron Triflate
Trifluoromethanesulfonic Acid Dicyclohexylboryl Ester;Dicyclohexyl{[(trifluoromethyl)sulphonyl]oxy}borane;Dicyclohexylboranyl trifluoromethanesulphonate, Dicyclohexylboranyl triflate | | CAS: | 145412-54-0 | | MF: | C13H22BF3O3S | | MW: | 326.18 | | EINECS: | | | Product Categories: | B (Classes of Boron Compounds);Borinic Acids | | Mol File: | 145412-54-0.mol |  |
| | Dicyclohexyl(trifluoromethanesulfonyloxy)borane Chemical Properties |
| Melting point | 59-65°C | | Boiling point | 337.9±52.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | 1S/C13H22BF3O3S/c15-13(16,17)21(18,19)20-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2 | | InChIKey | FBVDLYBQGQLANQ-UHFFFAOYSA-N | | SMILES | FC(F)(F)S(=O)(=O)OB(C1CCCCC1)C2CCCCC2 |
| Hazard Codes | C | | Risk Statements | 34-22 | | Safety Statements | 36/37/39-45-26 | | RIDADR | 1760 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2931900090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1B |
| | Dicyclohexyl(trifluoromethanesulfonyloxy)borane Usage And Synthesis |
| | Dicyclohexyl(trifluoromethanesulfonyloxy)borane Preparation Products And Raw materials |
|