| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate Basic information |
| | tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate Chemical Properties |
| Boiling point | 367.9±44.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 1.52±0.10(Predicted) | | form | solid | | InChI | 1S/C11H17N3O2/c1-11(2,3)16-10(15)14-9(12)6-8(13-14)7-4-5-7/h6-7H,4-5,12H2,1-3H3 | | InChIKey | LIRVTXMQFQGLQV-UHFFFAOYSA-N | | SMILES | NC1=CC(C2CC2)=NN1C(OC(C)(C)C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 |
| | tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate Usage And Synthesis |
| | tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate Preparation Products And Raw materials |
|