|
|
| | 2,3-bis(4-bromophenyl)fumaronitrile Basic information |
| Product Name: | 2,3-bis(4-bromophenyl)fumaronitrile | | Synonyms: | 2,3-bis(4-bromophenyl)fumaronitrile;trans-4,4'-dibromo-α,β-dicyanostilbene;2-Butenedinitrile, 2,3-bis(4-bromophenyl)-, (2E)-;(E)-2,3-Bis(4-bromophenyl)fumaronitrile;(E)-2,3-Bis(4-bromophenyl)fumaronitrile - [B90391] | | CAS: | 82193-93-9 | | MF: | C16H8Br2N2 | | MW: | 388.06 | | EINECS: | | | Product Categories: | | | Mol File: | 82193-93-9.mol |  |
| | 2,3-bis(4-bromophenyl)fumaronitrile Chemical Properties |
| Melting point | 216-217 °C | | Boiling point | 465.8±45.0 °C(Predicted) | | density | 1.676±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C16H8Br2N2/c17-13-5-1-11(2-6-13)15(9-19)16(10-20)12-3-7-14(18)8-4-12/h1-8H/b16-15+ | | InChIKey | RWHQRUSYDYNSTI-FOCLMDBBSA-N | | SMILES | C(#N)/C(/C1=CC=C(Br)C=C1)=C(\C1=CC=C(Br)C=C1)/C#N |
| | 2,3-bis(4-bromophenyl)fumaronitrile Usage And Synthesis |
| | 2,3-bis(4-bromophenyl)fumaronitrile Preparation Products And Raw materials |
|