|
|
| | Biphenyl-4-carboxamidine hydrochloride Basic information |
| Product Name: | Biphenyl-4-carboxamidine hydrochloride | | Synonyms: | 4-phenylbenzenecarboximidamide hydrochloride;[1,1'-Biphenyl]-4-carboximidamide monohydrochloride;4-PhenylbenzaMidine Hydrochloride;[1,1'-Biphenyl]-4-carboximidamide hydrochloride;Biphenyl -4- formamidine monohydrochloride;1,1'-Biphenyl]-4-carboximidamide hydrochloride;[1,1’-Biphenyl]-4-Formamidine Chloride;Biphenyl-4-carboxamidine hydrochloride | | CAS: | 111082-23-6 | | MF: | C13H13ClN2 | | MW: | 232.71 | | EINECS: | | | Product Categories: | | | Mol File: | 111082-23-6.mol |  |
| | Biphenyl-4-carboxamidine hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Powder | | InChI | InChI=1S/C13H12N2.ClH/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9H,(H3,14,15);1H | | InChIKey | WIYQWPDKLHFVLY-UHFFFAOYSA-N | | SMILES | C(N)(=N)C1C=CC(=CC=1)C1C=CC=CC=1.Cl |
| | Biphenyl-4-carboxamidine hydrochloride Usage And Synthesis |
| Uses | 4-Phenylbenzamidine hydrochloride is an amine derivative, which can be used as a pharmaceutical intermediate for pharmaceutical synthesis and pharmaceutical experimental research. |
| | Biphenyl-4-carboxamidine hydrochloride Preparation Products And Raw materials |
|