| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- B-IODO-9-BBN
-
- $1.10
-
2026-08-25
- CAS:70145-42-5
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | β-Iodo-9-BBN Basic information |
| Product Name: | β-Iodo-9-BBN | | Synonyms: | 9-IODO-9-BORABICYCLO[3.3.1]NONANE;B-IODO-9-BBN, 1.0M SOLUTION IN HEXANES;B-IODO-9-BBN 97%;9-iodo-9-borabicyclo[3.3.1]nonane solution;b-iodo-9-bbn solution;B-Iodo-9-BBN solution,9-Iodo-9-borabicyclo[3.3.1]nonane solution;B-Iodo-9-BBN solution 1.0 M in hexanes;B-IODO-9-BBN，1.0 M in hexanes | | CAS: | 70145-42-5 | | MF: | C8H14BI | | MW: | 247.91 | | EINECS: | | | Product Categories: | | | Mol File: | 70145-42-5.mol |  |
| | β-Iodo-9-BBN Chemical Properties |
| Boiling point | 55 °C/0.2 mmHg(lit.) | | density | 0.816 g/mL at 25 °C | | Fp | −9 °F | | storage temp. | Room Temperature, under inert atmosphere | | solubility | solution in hexanes, not soluble in aqueous media | | form | Dark Red Solution | | InChI | InChI=1S/C8H14BI/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8H,1-6H2 | | InChIKey | YAYIUFDUYUYPJC-UHFFFAOYSA-N | | SMILES | C12B(I)C(CCC1)CCC2 |
| | β-Iodo-9-BBN Usage And Synthesis |
| Uses | B-IODO-9-BBN is a coupling reagent used in the synthesis of cannabilactones, which act as a novel class of selective CB2 agonists. |
| | β-Iodo-9-BBN Preparation Products And Raw materials |
|