| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate Basic information |
| Product Name: | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate | | Synonyms: | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate;tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate1341037-08-8;2-Azaspiro[4.4]nonane-2-carboxylic acid, 7-amino-, 1,1-dimethylethyl ester;Octanoicacid,13-mercapto-;Benzene,1-(3-bromopropyl)-6-chloro-;2-Boc-7-amino-2-azaspiro[4.4]nonane;Boc-pyrrolidine-cyclopentanamine | | CAS: | 1341037-08-8 | | MF: | C13H24N2O2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1341037-08-8.mol | ![tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate Structure](CAS/20180703/GIF/1341037-08-8.gif) |
| | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate Chemical Properties |
| Boiling point | 336.5±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 10.77±0.20(Predicted) | | Appearance | Off-white to yellow Viscous Liquid | | InChI | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-7-6-13(9-15)5-4-10(14)8-13/h10H,4-9,14H2,1-3H3 | | InChIKey | BHCQMFFWISUOHK-UHFFFAOYSA-N | | SMILES | C1C2(CCC(N)C2)CCN1C(OC(C)(C)C)=O |
| | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate Usage And Synthesis |
| Uses | Tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate is primarily used in pharmaceutical synthesis and experimental research.
|
| | tert-butyl 7-amino-2-azaspiro[4.4]nonane-2-carboxylate Preparation Products And Raw materials |
|