| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Tosylate of Tetraethylene glycol monobenzyl ether manufacturers
- Benzyl-PEG4-Ots
-
-
2025-06-07
- CAS:89346-82-7
- Min. Order: 25g
- Purity: >98.00%
- Supply Ability: 25g
|
| | Tosylate of Tetraethylene glycol monobenzyl ether Basic information | | Physical Form |
| Product Name: | Tosylate of Tetraethylene glycol monobenzyl ether | | Synonyms: | Tosylate of Tetraethylene glycol monobenzyl ether;2,5,8,11-Tetraoxatridecan-13-ol, 1-phenyl-, 4-methylbenzenesulfonate;1-phenyl-2,5,8,11-tetraoxatridecan-13-yl 4-methylbenzenesulfonate;2-(2-benzyloxy)ethoxy)ethyl 4-methylbenzensulfonate;4-methylbenzenesulfonic acid,2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethanol;3,6,9,12-Tetraoxatridecan-1-ol, 13-phenyl-, 1-(4-methylbenzenesulfonate);TosO-(CH2CH2O)4-Bn;Tetraethylene glycol monobenzyl ether tosylate | | CAS: | 89346-82-7 | | MF: | C22H30O7S | | MW: | 438.53 | | EINECS: | | | Product Categories: | | | Mol File: | 89346-82-7.mol |  |
| | Tosylate of Tetraethylene glycol monobenzyl ether Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C22H30O7S/c1-20-7-9-22(10-8-20)30(23,24)29-18-17-27-14-13-25-11-12-26-15-16-28-19-21-5-3-2-4-6-21/h2-10H,11-19H2,1H3 | | InChIKey | VDKAUDYAZGYGDM-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)COCCOCCOCCOCC1=CC=CC=C1 |
| | Tosylate of Tetraethylene glycol monobenzyl ether Usage And Synthesis |
| Physical Form | Liquid or Solid or Semi-solid | | Uses | Benzyl-PEG4-Ots is a PEG-based PROTAC linker that can be used to synthesize PROTACs. | | in vitro | PROTAC contains two distinct ligands linked by a linker; one is a ligand for the E3 ubiquitin ligase and the other is a ligand for the target protein. PROTAC utilizes the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | | IC 50 | PEGs |
| | Tosylate of Tetraethylene glycol monobenzyl ether Preparation Products And Raw materials |
| Preparation Products | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol-->1,27-Diphenyl-2,5,8,11,14,17,20,23,26-nonaoxaheptacosane |
|