|
3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol Suppliers list
|
| Company Name: |
career henan chemical co |
| Tel: |
+86-0371-86658258 +8613203830695 |
| Email: |
factory@coreychem.com |
| Products Intro: |
Product Name:3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol CAS:17598-96-8 Purity:95~99.9% Package:1g;2USD
|
|
|
|
|
- 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol
-
- $2.00
-
2020-03-06
- CAS:17598-96-8
- Min. Order: 1g
- Purity: 95~99.9%
- Supply Ability: 5KG
|
| | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol Basic information |
| Product Name: | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol | | Synonyms: | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol;2,2'-[1,2-Ethanediylbis[oxy(2,1-ethanediyl)oxy(2,1-ethanediyl)oxy(2,1-ethanediyl)oxy(2,1-ethanediyl)oxy(2,1-ethanediyl)oxy]]bis(ethanol);3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxa-1,38-octatriacontanediol;Einecs 241-569-7;CAS_17598-96-8;3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxaoctatriacontan-1,38-diol;2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;Inhibitor,HO-PEG-13-OH,inhibit,PROTAC Linkers,HOPEG13OH,HO PEG13 OH | | CAS: | 17598-96-8 | | MF: | C26H54O14 | | MW: | 590.69856 | | EINECS: | 2415697 | | Product Categories: | | | Mol File: | 17598-96-8.mol |  |
| | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol Chemical Properties |
| Boiling point | 631.6±50.0 °C(Predicted) | | density | 1.116±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 14.06±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C26H54O14/c27-1-3-29-5-7-31-9-11-33-13-15-35-17-19-37-21-23-39-25-26-40-24-22-38-20-18-36-16-14-34-12-10-32-8-6-30-4-2-28/h27-28H,1-26H2 | | InChIKey | AKWFJQNBHYVIPY-UHFFFAOYSA-N | | SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol Usage And Synthesis |
| Description | PEG14 is a PEG chain consisting of 13 ethylene glycol subunits and two terminal hydroxyl groups. The hydroxyl groups can participate in reactions to further derivatize the compound. The hydrophilic PEG chain increases the water solubility of the compound in aqueous media. The water solubility properties of the PEG linker are enhanced with longer PEG chains. | | Uses | HO-PEG13-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatriacontane-1,38-diol Preparation Products And Raw materials |
|