|
|
| | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) Basic information |
| Product Name: | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) | | Synonyms: | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II);[(1,2,3-η)-(2E)-2-Buten-1-yl]chloro[tris(1,1-dimethylethyl)phosphine]palladium;(E)-but-1-enyl]-chloro-palladium tritert-butylphosphane;[p(tBu)3]Pd(crotyl)Cl;PD-162;PdCl(crotyl)(PtBu3) | | CAS: | 1334497-00-5 | | MF: | C16H34ClPPd | | MW: | 399.287921 | | EINECS: | | | Product Categories: | | | Mol File: | 1334497-00-5.mol |  |
| | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Powder | | Water Solubility | It is insoluble in water. | | InChI | InChI=1S/C12H27P.C4H7.ClH.Pd/c1-10(2,3)13(11(4,5)6)12(7,8)9;1-3-4-2;;/h1-9H3;3-4H,1H2,2H3;1H;/q;;;+1/p-1/b;4-3+;; | | InChIKey | UOHSKCLJZDRCDS-NXZCPFRHSA-M | | SMILES | P(C(C)(C)C)(C(C)(C)C)C(C)(C)C.[Pd](Cl)C/C=C/C |
| | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) Usage And Synthesis |
| Uses | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) is also used in C-C Coupling. | | Synthesis | In a nitrogen-filled glove box, tri-tert-butylphosphine and allyl were added to a 10 ml dry reaction vial as catalyst, and finally dry and dewatered tetrahydrofuran was added to the reaction mixture as solvent, and the resulting reaction mixture was stirred in the glove box at room temperature for 30 minutes. At the end of the reaction, the solvent tetrahydrofuran was removed from the reaction mixture under vacuum to give a light yellow solid as the desired target product catalyst chloro(crotonyl)(tri-tert-butylphosphine)palladium(II). |
| | Chloro(crotyl)(tri-tert-butylphosphine)palladium(II) Preparation Products And Raw materials |
|