| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 2-O-(p-Nitrophenyl)-alpha-D-N-acetylneuraminic acid Basic information |
| | 2-O-(p-Nitrophenyl)-alpha-D-N-acetylneuraminic acid Chemical Properties |
| Boiling point | 853.315±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.613±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | methanol: 25mg/mL, clear, colorless to faintly yellow | | form | powder | | pka | 1.391±0.70(predicted) | | InChI | 1S/C17H22N2O11/c1-8(21)18-13-11(22)6-17(16(25)26,30-15(13)14(24)12(23)7-20)29-10-4-2-9(3-5-10)19(27)28/h2-5,11-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26) | | InChIKey | OICUZSPXIJAAEA-UHFFFAOYSA-N | | SMILES | CC(=O)NC1C(O)CC(OC1C(O)C(O)CO)(Oc2ccc(cc2)N(=O)=O)C(O)=O |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38-40 | | Safety Statements | 22-26-36/37/39-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-O-(p-Nitrophenyl)-alpha-D-N-acetylneuraminic acid Usage And Synthesis |
| Uses | 2-O-(p-Nitrophenyl)-α-D-N-acetylneuraminic acid may be used as a substrate to measure sialidase enzyme activity. | | Biological Activity | 2-O-(p-Nitrophenyl)-α-D-N-acetylneuraminic acid serves as a sialyl donor in enzyme-catalyzed trans-sialylation. |
| | 2-O-(p-Nitrophenyl)-alpha-D-N-acetylneuraminic acid Preparation Products And Raw materials |
|