| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| Product Name: | B32B3 | | Synonyms: | B32B3;4-[2-(1H-Indol-3-ylmethylene)hydrazino]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin;4-[2-(1H-Indol-3-ylmethylene)hydrazino]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine;B32B3 >=95% (HPLC);1H-Indole-3-carboxaldehyde, 2-(5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)hydrazone;VprBP Inhibitor, B32B3;3-{2-[(1H-Indol-3-yl)methylidene]hydrazin-1-yl}-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraene | | CAS: | 294193-86-5 | | MF: | C19H17N5S | | MW: | 347.44 | | EINECS: | | | Product Categories: | | | Mol File: | 294193-86-5.mol |  |
| | B32B3 Chemical Properties |
| Boiling point | 623.9±55.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 50mg/mL | | form | powder | | pka | 9.12±0.20(Predicted) | | color | light yellow to dark yellow | | InChI | 1S/C19H17N5S/c1-3-7-15-13(5-1)12(9-20-15)10-23-24-18-17-14-6-2-4-8-16(14)25-19(17)22-11-21-18/h1,3,5,7,9-11,20H,2,4,6,8H2,(H,21,22,24) | | InChIKey | AKDKHZVFMAWBFX-UHFFFAOYSA-N | | SMILES | C1(C(NN=CC2=CNC3=C2C=CC=C3)=NC=N4)=C4SC5=C1CCCC5 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | B32B3 Usage And Synthesis |
| Uses | B32B3 is a cell permeable ATP-competitive inhibitor. of VprBP blocking histone phosphorylation which acts as an anti-proliferative agent. Also may be used as an anti-HIV agent, as its a characteristic of lentiviruses. | | Biological Activity | Cell permeable: yes', 'Primary Target
VprBP', 'Reversible: yes |
| | B32B3 Preparation Products And Raw materials |
|