TZ-9 manufacturers
- TZ9
-
- $46.00
-
2026-07-27
- CAS:1002789-86-7
- Purity: 99.69%
- Supply Ability: 10g
|
| Product Name: | TZ-9 | | Synonyms: | TZ9;TZ-9;B4861;CS-3536;1,3,5-Triazine-2-methanol, 4-amino-6-(phenylamino)-, 2-(4-nitrobenzoate);SMI# 9;TZ9,TZ-9;(4-Amino-6-(phenylamino)-1,3,5-triazin-2-yl)methyl 4-nitrobenzoate | | CAS: | 1002789-86-7 | | MF: | C17H14N6O4 | | MW: | 366.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1002789-86-7.mol |  |
| Boiling point | 675.9±65.0 °C(Predicted) | | density | 1.477±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS(pH 7.2) (1:2): 0.3 mg/ml | | pka | 3.69±0.10(Predicted) | | form | Powder | | color | Light yellow to yellow | | InChI | 1S/C17H14N6O4/c18-16-20-14(21-17(22-16)19-12-4-2-1-3-5-12)10-27-15(24)11-6-8-13(9-7-11)23(25)26/h1-9H,10H2,(H3,18,19,20,21,22) | | InChIKey | RRRDZFQRNJTKHL-UHFFFAOYSA-N | | SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)N)COC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| Uses | TZ9 is a selective Rad6 inhibitor. TZ9 inhibits Rad6B-induced histone H2A ubiquitination, downregulates intracellular β-catenin, induces G2-M arrest and apoptosis, and inhibits the proliferation and migration of metastatic human breast cancer cells[1]. | | Biological Activity | Cell permeable: yes', 'Primary Target Rad6B/HHR6B', 'Reversible: yes | | References | [1] Sanders MA, et al. Novel inhibitors of Rad6 ubiquitin conjugating enzyme: design, synthesis, identification, and functional characterization. Mol Cancer Ther. 2013 Apr;12(4):373-83. DOI:10.1158/1535-7163.MCT-12-0793 |
| | TZ-9 Preparation Products And Raw materials |
|