| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3,5-tris(4-pyridyl)benzene Basic information |
| Product Name: | 1,3,5-tris(4-pyridyl)benzene | | Synonyms: | 1,3,5-tris(4-pyridyl)benzene;Pyridine, 4,4',4''-(1,3,5-benzenetriyl)tris-;1,3,5-tri(pyridin-4-yl) benzene;4,4',4''-(1,3,5-benzenetriyl)tris-Pyridine;4-(3,5-dipyridin-4-ylphenyl)pyridine;4- (3,5-diphyridin-4-ylphenyl) pyridine;4-[3,5-Bis(pyridin-4-yl)phenyl]pyridine;1,3,5-tri(pyridine-4-yl)benzene | | CAS: | 170165-84-1 | | MF: | C21H15N3 | | MW: | 309.36 | | EINECS: | | | Product Categories: | | | Mol File: | 170165-84-1.mol |  |
| | 1,3,5-tris(4-pyridyl)benzene Chemical Properties |
| Melting point | >300 °C | | Boiling point | 488.6±40.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.96±0.10(Predicted) | | Appearance | White to light brown Solid | | InChI | InChI=1S/C21H15N3/c1-7-22-8-2-16(1)19-13-20(17-3-9-23-10-4-17)15-21(14-19)18-5-11-24-12-6-18/h1-15H | | InChIKey | ZMQLKBAJUGKDDO-UHFFFAOYSA-N | | SMILES | C1(C2C=CN=CC=2)=CC(C2C=CN=CC=2)=CC(C2C=CN=CC=2)=C1 |
| | 1,3,5-tris(4-pyridyl)benzene Usage And Synthesis |
| Uses | 1,3,5-Tris(4-pyridyl)benzene is used as a ligand in the synthesis of MOF materials. |
| | 1,3,5-tris(4-pyridyl)benzene Preparation Products And Raw materials |
|