|
|
| | 1,3,5-Tris(p-formylphenyl)benzene Basic information |
| Product Name: | 1,3,5-Tris(p-formylphenyl)benzene | | Synonyms: | 1,3,5-Tris(p-formylphenyl)benzene;1,4-Di-(p-benzaldehydyl)-naphthalene;HT014, 5'-(4-Formylphenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarbaldehyde;1,3,5-tris (4'-aldehyde phenyl) benzene;[1,1':3',1''-Terphenyl]-4,4''-dicarboxaldehyde, 5'-(4-formylphenyl)-;4-[3,5-Bis(4-Formylphenyl)Phenyl]Benzaldehyde;5'-(4-Formylphenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarboxaldehyde;5'-(4-Formylphenyl)-[1,1':3',1''-terphenyl]-3,3''-dicarbaldehyde | | CAS: | 118688-53-2 | | MF: | C27H18O3 | | MW: | 390.43 | | EINECS: | | | Product Categories: | | | Mol File: | 118688-53-2.mol |  |
| | 1,3,5-Tris(p-formylphenyl)benzene Chemical Properties |
| Melting point | 230-234 °C | | Boiling point | 612.3±55.0 °C(Predicted) | | density | 1.219±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Light yellow to Light orange | | λmax | 296(CH3CN) nm | | InChI | InChI=1S/C27H18O3/c28-16-19-1-7-22(8-2-19)25-13-26(23-9-3-20(17-29)4-10-23)15-27(14-25)24-11-5-21(18-30)6-12-24/h1-18H | | InChIKey | ZCJZVMNBJKPQEV-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C3=CC=C(C=O)C=C3)=CC(C3=CC=C(C=O)C=C3)=C2)=CC=C(C=O)C=C1 | | CAS DataBase Reference | 118688-53-2 |
| | 1,3,5-Tris(p-formylphenyl)benzene Usage And Synthesis |
| Uses | 1,3,5-Tris(p-formylphenyl)benzene is an organic synthesis intermediate and pharmaceutical intermediate that can be used in laboratory organic synthesis processes and in chemical and pharmaceutical research and development processes. |
| | 1,3,5-Tris(p-formylphenyl)benzene Preparation Products And Raw materials |
|