|
|
| | tert-butyl(4-(3-(dimethoxyphosphoryl)-2-oxopropyl)phenyl)carbamate Basic information |
| | tert-butyl(4-(3-(dimethoxyphosphoryl)-2-oxopropyl)phenyl)carbamate Chemical Properties |
| Boiling point | 436.7±35.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 13.60±0.70(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C16H24NO6P/c1-16(2,3)23-15(19)17-13-8-6-12(7-9-13)10-14(18)11-24(20,21-4)22-5/h6-9H,10-11H2,1-5H3,(H,17,19) | | InChIKey | ZALILTZJEZWNEH-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=C(CC(=O)CP(OC)(OC)=O)C=C1 |
| | tert-butyl(4-(3-(dimethoxyphosphoryl)-2-oxopropyl)phenyl)carbamate Usage And Synthesis |
| Uses | [3-(4-tert-Butoxycarbonylamino-phenyl)-2-oxo-propyl]-phosphonic Acid Dimethyl Ester can be used as reactant/reagent in process for preparation of beta-3 agonists with key step of amidation of dibenzylpyrrolidine intermediate. | | Pharmaceutical Applications | In medical chemistry, tert-butyl(4-(3-(dimethoxyphosphoryl)-2-oxopropyl)phenyl)carbamate can be involved in synthesis of Vibegron, a prescription oral tablet used to treat adult overactive bladder (OAB) symptoms. |
| | tert-butyl(4-(3-(dimethoxyphosphoryl)-2-oxopropyl)phenyl)carbamate Preparation Products And Raw materials |
|