| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Magic acid Basic information |
| Product Name: | Magic acid | | Synonyms: | FLUOROSULFURIC ACID-ANTIMONY PENTAFLUORIDE, 1:1;hydrogen pentafluoro(fluorosulphato-O)antimonate(1-);MAGIC ACID, 100%;25% MAGIC ACID SPECTROGRADE;100% MAGIC ACID SPECTROGRADE;25%Magicacid;Spectrograde;Fluorosulfuric acid-antimony pentafluoride 4:1 | | CAS: | 23854-38-8 | | MF: | F6HO3SSb | | MW: | 316.82 | | EINECS: | 245-915-8 | | Product Categories: | | | Mol File: | 23854-38-8.mol |  |
| | Magic acid Chemical Properties |
| Melting point | -89.0 °C | | Boiling point | 162.7 °C | | storage temp. | -20°C | | solubility | sol SO2ClF, liquid SO2; solubilizes most organic compounds that are potential proton acceptors. | | InChI | 1S/FHO3S.5FH.Sb/c1-5(2,3)4;;;;;;/h(H,2,3,4);5*1H;/q;;;;;;+5/p-5 | | InChIKey | QNDPUZFBWUBSNH-UHFFFAOYSA-I | | SMILES | OS(F)(=O)=O.F[Sb](F)(F)(F)F |
| Hazard Codes | T,N,C | | Risk Statements | 14-23/24/25-34-51/53-35-20/22 | | Safety Statements | 26-27-36/37/39-45-61 | | RIDADR | UN 2922 8/PG 1 | | WGK Germany | 2 | | HazardClass | 8 | | PackingGroup | I | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Corr. 1A |
| | Magic acid Usage And Synthesis |
| Uses | Magic acid is a strong conjugate Brnsted-Lewis superacid system widely used for the generation of stable carbocations and as catalyst and reagent for alkylation, isomerization, rearrangement, cyclization, oxyfunctionalization, formylation, sulfonation, and fluorosulfonation. | | Preparation | HSO3F-SbF5 is prepared by mixing Fluorosulfuric Acid and Antimony(V) Fluoride at rt under dry nitrogen or argon atmosphere. The commercially available Magic Acid is a 50:50 mol % mixture of the two components. Magic Acid diluted in fluorosulfuric acid to various extents is also available. Commercial Magic Acid generally contains some HF in the form of conjugate acid. | | storage | Magic Acid is highly toxic, moisture sensitive, and corrosive, and should always be handled in a fume hood with proper protection. Glass is attacked by Magic Acid very slowly when moisture is excluded. Therefore, glassware may be used for handling and carrying out reactions involving Magic Acid. Teflon containers are recommended for long-term laboratory storage of Magic Acid. |
| | Magic acid Preparation Products And Raw materials |
|