|
|
| | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline Basic information |
| Product Name: | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline | | Synonyms: | BUTTPARK 48\04-95;6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline95+%;6-Bromo-2-(trifluoromethyl)quinolin-4-ol;6-BroMo-2(trifluorMethyl) quinoline-4-ol;6-bromo-2-(trifluoromethyl)-1H-quinolin-4-one;JR-8822, 6-Bromo-4-hydroxy-2-trifluoromethylquinoline, 97%;4-Quinolinol, 6-bromo-2-(trifluoromethyl)-;6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline | | CAS: | 1701-22-0 | | MF: | C10H5BrF3NO | | MW: | 292.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1701-22-0.mol |  |
| | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline Chemical Properties |
| Melting point | >290°C | | Boiling point | 354.6±37.0 °C(Predicted) | | density | 1.771±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 6.16±0.40(Predicted) | | Appearance | White to light brown Solid | | InChI | 1S/C10H5BrF3NO/c11-5-1-2-7-6(3-5)8(16)4-9(15-7)10(12,13)14/h1-4H,(H,15,16) | | InChIKey | HIBGBUAHZUWVNW-UHFFFAOYSA-N | | SMILES | Oc1cc(nc2ccc(Br)cc12)C(F)(F)F | | CAS DataBase Reference | 1701-22-0(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline Usage And Synthesis |
| | 6-Bromo-4-hydroxy-2-(trifluoromethyl)quinoline Preparation Products And Raw materials |
|