|
|
| | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate Basic information |
| Product Name: | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate | | Synonyms: | 3-(2-benzothiazolylthio)-1-propanesulfonicacisodiumsalt;3-(benzothiazol-2-ylthio)-1-propanesul-fonicacidso-salt;3-(BENZOTHIAZOL-2-YLTHIO)-1-PROPANESULFONIC ACID SODIUM SALT;Sodium 3-(benzo[d]thiazol-2-ylthio)propane-1-sulfonate;ZPS(3-(benzothiazolyl-2-mercapto)-propylsulfonate ,sodium salt);sodium 3-(1,3-benzothiazol-2-ylthio)-1-propanesulfonate;1-PROPANESULFONIC ACID, 3-(2-BENZOTHIAZOLYLTHIO)-, SODIUM SALT;3-(2-BENZOTHIAZOLYLTHIO)1-PROPANESULFONIC ACID | | CAS: | 49625-94-7 | | MF: | C10H10NNaO3S3 | | MW: | 311.38 | | EINECS: | 256-401-8 | | Product Categories: | Organic acids | | Mol File: | 49625-94-7.mol |  |
| | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate Chemical Properties |
| Melting point | ≥320 °C (dec.) | | density | 1.593-1.597g/cm3 at 22℃ | | Fp | 110 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid:particulate/powder | | InChI | InChI=1S/C10H11NO3S3.Na/c12-17(13,14)7-3-6-15-10-11-8-4-1-2-5-9(8)16-10;/h1-2,4-5H,3,6-7H2,(H,12,13,14);/q;+1/p-1 | | InChIKey | VRKNGZAPJYUNSN-UHFFFAOYSA-M | | SMILES | C12C=CC=CC=1SC(SCCCS([O-])(=O)=O)=N2.[Na+] | | LogP | -1.7 at 21.1℃ | | Surface tension | 72.5mN/m at 1g/L and 20℃ | | CAS DataBase Reference | 49625-94-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanesulfonic acid, 3-(2-benzothiazolylthio)-, sodium salt (49625-94-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate Usage And Synthesis |
| Uses | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate may be used in the chemical synthesis studies. |
| | Sodium 3-(benzothiazol-2-ylthio)-1-propanesulfonate Preparation Products And Raw materials |
|