|
|
| | Chloroethane-d5 Basic information |
| Product Name: | Chloroethane-d5 | | Synonyms: | ETHYL CHLORIDE-D5;Ethane-D5, chloro-;chloro-pentadeuterio-ethane;CHLOROETHANE (D5, 98%) 1000 UG/ML IN METHANOL;Chloroethane-d5;Chloroethane (D?, 98%) 1000 μg/mL in methanol;Chloroethane (D?, 98%);Chloroethane-d5 | | CAS: | 19199-91-8 | | MF: | C2H5Cl | | MW: | 64.51 | | EINECS: | | | Product Categories: | | | Mol File: | 19199-91-8.mol |  |
| | Chloroethane-d5 Chemical Properties |
| InChI | 1S/C2H5Cl/c1-2-3/h2H2,1H3/i1D3,2D2 | | InChIKey | HRYZWHHZPQKTII-ZBJDZAJPSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])Cl | | EPA Substance Registry System | Chloroethane-d5 (19199-91-8) | | CAS Number Unlabeled | 75-00-3 |
| Hazard Codes | F+,Xn | | Risk Statements | 12-40-52/53 | | Safety Statements | 9-16-33-36/37-61 | | WGK Germany | WGK 2 | | Storage Class | 2A - Gases | | Hazard Classifications | Aquatic Chronic 3
Carc. 2
Flam. Gas 1B |
| | Chloroethane-d5 Usage And Synthesis |
| | Chloroethane-d5 Preparation Products And Raw materials |
|