| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Cholesteryl chloroformate manufacturers
|
| | Cholesteryl chloroformate Basic information |
| | Cholesteryl chloroformate Chemical Properties |
| Melting point | 115-117 °C (lit.) | | alpha | -28 º (c=2, CHCl3 27 ºC) | | Boiling point | 556.35°C (rough estimate) | | density | 0.9344 (rough estimate) | | refractive index | 1.5330 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | SLOWLY HYDROLYZED | | form | Crystalline Powder | | color | White to off-white | | Optical Rotation | [α]27/D 28°, c = 2 in chloroform | | Water Solubility | SLOWLY HYDROLYZED | | Sensitive | Moisture Sensitive | | BRN | 3223154 | | InChIKey | QNEPTKZEXBPDLF-JDTILAPWSA-N | | SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(Cl)=O | | CAS DataBase Reference | 7144-08-3(CAS DataBase Reference) | | EPA Substance Registry System | Cholest-5-en-3-ol (3.beta.)-, carbonochloridate (7144-08-3) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159020 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Cholesteryl chloroformate Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Cholesteryl chloroformate is used in the preparation of hydrophobized chitosan oligosaccharide, which finds application as an efficient gene carrier. It acts as an initiator in the polymerization of methyl methacrylate. |
| | Cholesteryl chloroformate Preparation Products And Raw materials |
|