|
|
| | 4-acetyl-1-naphthoic acid Basic information |
| Product Name: | 4-acetyl-1-naphthoic acid | | Synonyms: | 1-Naphthalenecarboxylic acid, 4-acetyl-;4-acetyl-1-naphthalenecarboxylic acid;4-acetylnaphthalene-1-carboxylicaci;1-Naphthalenecarboxylic acid, 4-acetyl- ISO 9001：2015 REACH;afoxolaner-004;4-acetylnaphthalene-1-carboxylic acid;4-acetyl-1-naphtoic acid;4-acetyl-1-naphthoic | | CAS: | 131986-05-5 | | MF: | C13H10O3 | | MW: | 214.22 | | EINECS: | | | Product Categories: | | | Mol File: | 131986-05-5.mol |  |
| | 4-acetyl-1-naphthoic acid Chemical Properties |
| Melting point | 184 °C | | Boiling point | 442.9±28.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | pka | 2.85±0.10(Predicted) | | form | powder | | color | Faint yellow | | InChI | InChI=1S/C13H10O3/c1-8(14)9-6-7-12(13(15)16)11-5-3-2-4-10(9)11/h2-7H,1H3,(H,15,16) | | InChIKey | DOCFRBZXXQJPBD-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=C2C(C=CC=C2)=C(C(C)=O)C=C1 |
| | 4-acetyl-1-naphthoic acid Usage And Synthesis |
| Uses | 4-acetyl-1-naphthoic acid is kind of mono-constituent substance, it is useful research chemical. |
| | 4-acetyl-1-naphthoic acid Preparation Products And Raw materials |
|