|
|
| | 1-(2-Methyl-thiazol-4-yl)-ethylamine Basic information |
| Product Name: | 1-(2-Methyl-thiazol-4-yl)-ethylamine | | Synonyms: | 1-(2-methylthiazol-4-yl)ethanamine dihydrochloride;CHEMBRDG-BB 4101060;1-(2-Methyl-1,3-thiazol-4-yl)ethanamine dihydrochloride;1-(2-methyl-4-thiazolyl)ethanamine;[1-(2-methyl-1,3-thiazol-4-yl)ethyl]amine dihydrochloride;1-(2-methyl-1,3-thiazol-4-yl)ethanamine;4-Thiazolemethanamine, .alpha.,2-dimethyl-;1-(2-methyl-1,3-thiazol-4-yl)ethanamine(SALTDATA: 2HCl) | | CAS: | 317830-81-2 | | MF: | C6H10N2S | | MW: | 142.22 | | EINECS: | | | Product Categories: | | | Mol File: | 317830-81-2.mol |  |
| | 1-(2-Methyl-thiazol-4-yl)-ethylamine Chemical Properties |
| Boiling point | 221.8±15.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 8.11±0.29(Predicted) | | InChI | 1S/C6H10N2S.2ClH/c1-4(7)6-3-9-5(2)8-6;;/h3-4H,7H2,1-2H3;2*1H | | InChIKey | NSIYHWIWQYUIEN-UHFFFAOYSA-N | | SMILES | NC(C)C1=CSC(C)=N1.[H]Cl.[H]Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(2-Methyl-thiazol-4-yl)-ethylamine Usage And Synthesis |
| | 1-(2-Methyl-thiazol-4-yl)-ethylamine Preparation Products And Raw materials |
|