| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3,4'-DI-ISO-PROPYLBIPHENYL manufacturers
|
| | 3,4'-DI-ISO-PROPYLBIPHENYL Basic information |
| Product Name: | 3,4'-DI-ISO-PROPYLBIPHENYL | | Synonyms: | 1,1'-Biphenyl, 3,4'-bis-(1-methylethyl);1,1'-Biphenyl, 3,4'-diisopropyl;3,4'-Diisopropyl-1,1'-biphenyl;TIMTEC-BB SBB007851;3,4'-DI-ISO-PROPYLBIPHENYL;3,4'-DI-ISO-PROPYLBIPHENY;1-propan-2-yl-3-(4-propan-2-ylphenyl)benzene;3,4'-Bis(1-methylethyl)-1,1'-biphenyl | | CAS: | 61434-46-6 | | MF: | C18H22 | | MW: | 238.37 | | EINECS: | | | Product Categories: | | | Mol File: | 61434-46-6.mol |  |
| | 3,4'-DI-ISO-PROPYLBIPHENYL Chemical Properties |
| Boiling point | 336.1±22.0 °C(Predicted) | | density | 0.935±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C18H22/c1-13(2)15-8-10-16(11-9-15)18-7-5-6-17(12-18)14(3)4/h5-14H,1-4H3 | | InChIKey | LHNUPUGVRFQTLK-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(C)C)C=C2)=CC=CC(C(C)C)=C1 |
| | 3,4'-DI-ISO-PROPYLBIPHENYL Usage And Synthesis |
| | 3,4'-DI-ISO-PROPYLBIPHENYL Preparation Products And Raw materials |
|