| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:2,5-Dichloro-6-methylnicotinonitrile CAS:84703-17-3 Purity:97% Package:100mg;250mg;1g Remarks:BD651482
|
| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:2,5-Dichloro-6-methyl-nicotinonitrile CAS:84703-17-3 Purity:>97% Package:1g;5g;10g;25g Remarks:B1-3993
|
| Company Name: |
Henan Weituxi Chemical Technology Co., Ltd.
|
| Tel: |
0371-63284658 18135795563 |
| Email: |
3905209149@qq.com |
| Products Intro: |
Product Name:2,5-Dichloro-6-methyl-nicotinonitrile CAS:84703-17-3 Purity:98% Package:100mg;500mg;1g;5g;25g
|
| Company Name: |
Nanjing shengyilai Chemical Co., Ltd
|
| Tel: |
19951936396 |
| Email: |
3158688292@qq.com |
| Products Intro: |
Product Name:2,5-Dichloro-6-methyl-nicotinonitrile CAS:84703-17-3 Purity:98% Package:1g;100g;1kg;100kg
|
|
| | 2,5-Dichloro-6-methyl-nicotinonitrile Basic information |
| | 2,5-Dichloro-6-methyl-nicotinonitrile Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H4Cl2N2/c1-4-6(8)2-5(3-10)7(9)11-4/h2H,1H3 | | InChIKey | WNNMMPADSQWJTO-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=C(Cl)C=C1C#N |
| | 2,5-Dichloro-6-methyl-nicotinonitrile Usage And Synthesis |
| | 2,5-Dichloro-6-methyl-nicotinonitrile Preparation Products And Raw materials |
|