| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(4-Methylphenyl)-2-furoic acid Basic information |
| Product Name: | 5-(4-Methylphenyl)-2-furoic acid | | Synonyms: | CHEMBRDG-BB 4401948;5-P-TOLYL-FURAN-2-CARBOXYLIC ACID;AKOS BAR-0046;5-(4-Tolyl)-furane-2-carboxylic acid;5-(4-methylphenyl)-2-furoic acid(SALTDATA: FREE);5-(4-Methylphenyl)furan-2-carboxylic acid, 2-Carboxy-5-(4-methylphenyl)furan, 4-(5-Carboxyfur-2-yl)toluene;5-(4-Methylphenyl)-2-furoic acid 97%;5-(4-methylphenyl)-2-furancarboxylic acid | | CAS: | 52938-98-4 | | MF: | C12H10O3 | | MW: | 202.21 | | EINECS: | | | Product Categories: | Building Blocks;Furans;Heterocyclic Building Blocks | | Mol File: | 52938-98-4.mol |  |
| | 5-(4-Methylphenyl)-2-furoic acid Chemical Properties |
| Melting point | 179-181 °C (lit.) | | Boiling point | 374.6±30.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.21±0.10(Predicted) | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C12H10O3/c1-8-2-4-9(5-3-8)10-6-7-11(15-10)12(13)14/h2-7H,1H3,(H,13,14) | | InChIKey | YZDIEQFFXQUBRM-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)-c2ccc(o2)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2932190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-(4-Methylphenyl)-2-furoic acid Usage And Synthesis |
| Synthesis | Step 3: Accurately weigh 310 mg (1.11 mmol) of the intermediate methyl 4-(4-methoxyphenyl)furan-2-carboxylate and add it slowly dropwise to a 5 mL methanol mixture containing 1 mL of 4 mol/L NaOH solution and heat to reflux for 3 hours. After completion of the reaction, the reaction mixture was cooled to room temperature and concentrated to dryness under reduced pressure. The pH was adjusted to about 1 with 10% dilute hydrochloric acid and subsequently extracted three times with ethyl acetate. The organic phases were combined, washed twice with saturated sodium chloride solution, dried over anhydrous sodium sulfate and concentrated under reduced pressure to give 290 mg of the intermediate 5-(4-methoxyphenyl)furan-2-carboxylic acid in 100% yield. | | References | [1] Patent: CN103992311, 2017, B. Location in patent: Paragraph 0103; 0137 |
| | 5-(4-Methylphenyl)-2-furoic acid Preparation Products And Raw materials |
|