Tri-n-butyl-d27 phosphate manufacturers
|
| | Tri-n-butyl-d27 phosphate Basic information |
| Product Name: | Tri-n-butyl-d27 phosphate | | Synonyms: | TRIBUTYL PHOSPHATE (D27, 98-99%) 1MG/ML IN ACETONITRILE;[2H2]-Tri-n-butyl7 Phosphate;[2H27]-Phosphoric Acid Tributyl Ester;Tri-n-butyl phophate-d27;Tri-n-butyl phosphate-d27;Tri-n-butyl phosphate-d27 in isooctane;Tri-n-butyl phosphate-d27 in acetonitrile;butylphosphate-D27 | | CAS: | 61196-26-7 | | MF: | C12H18D9O4P | | MW: | 275.37 | | EINECS: | | | Product Categories: | | | Mol File: | 61196-26-7.mol |  |
| | Tri-n-butyl-d27 phosphate Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Hygroscopic | | InChI | InChI=1S/C12H27O4P/c1-4-7-10-14-17(13,15-11-8-5-2)16-12-9-6-3/h4-12H2,1-3H3/i1D3,4D2,7D2,10D2 | | InChIKey | STCOOQWBFONSKY-CWKDUQAWSA-N | | SMILES | P(=O)(OCCCC)(OCCCC)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 126-73-8 |
| | Tri-n-butyl-d27 phosphate Usage And Synthesis |
| Uses | Isotope labelled Phosphoric Acid Tributyl Ester is used as a solvent in the solvent-detergent method for production of immunoglobulin for inactivation of viruses with lipid envelope on the model of duck hepatitis B virus. It is also used as a ligand in the extraction of lanthanide ions from solid and liquid materials by supercritical CO2. |
| | Tri-n-butyl-d27 phosphate Preparation Products And Raw materials |
|