| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tetrahexylammonium hydroxide Basic information |
| | Tetrahexylammonium hydroxide Chemical Properties |
| refractive index | n20/D 1.402 | | Fp | 11 °C | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 6019685 | | InChI | 1S/C24H52N.H2O/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;/h5-24H2,1-4H3;1H2/q+1;/p-1 | | InChIKey | JCJNUSDBRRKQPC-UHFFFAOYSA-M | | SMILES | [OH-].CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| Hazard Codes | C,T,F | | Risk Statements | 34-23/25-11-39/23/24/25-23/24/25 | | Safety Statements | 7-16-24-33-45-36/37/39-27-26 | | RIDADR | UN 3286 3/PG 2 | | WGK Germany | 1 | | F | 9-34 | | HS Code | 2923.90.0100 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B STOT SE 1 |
| | Tetrahexylammonium hydroxide Usage And Synthesis |
| Uses | Tetrahexylammonium hydroxide is a phase-transfer reagent that can be used:
- To synthesize β-D-xyloside- and β-D-xylobioside-based ionic liquids containing tetrahexylammonium cation.
- As an alkali-free gelling agent to prepare amorphous microporous silica-alumina.
- To synthesize tetrahexylammonium prolinate, a promising candidate to prepare a solid supported ionic liquid phase (SILP) carbon dioxide absorber.
|
| | Tetrahexylammonium hydroxide Preparation Products And Raw materials |
|