|
|
| | 2'-Deoxyadenosine-5'-monophosphate disodium salt Basic information |
| Product Name: | 2'-Deoxyadenosine-5'-monophosphate disodium salt | | Synonyms: | 2''-DEOXYADENOSINE-5''-MONOPHOSPHATE DISODIUM SALT (DAMP);2-DEOXYADENOSINE-5-MONOPHOSPHATE DISODIUM SALT extrapure;2'-Deoxyadenosine 5'-phosphoric acid disodium salt;[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-tetrahydrofuran-2-yl]methyl dihydrogen phosphate;[(2R,3S,5R)-5-(6-azanylpurin-9-yl)-3-hydroxy-oxolan-2-yl]methyl dihydrogen phosphate;2’-Deoxyadenosine-5’-monophosphate disodium sa;2'-DEOXYADENYLIC ACID SODIUM SALT | | CAS: | 2922-74-9 | | MF: | C10H15N5NaO6P | | MW: | 355.22 | | EINECS: | 220-873-3 | | Product Categories: | Pharmaceutical | | Mol File: | 2922-74-9.mol |  |
| | 2'-Deoxyadenosine-5'-monophosphate disodium salt Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | H2O: 50 mg/mL, clear, colorless | | form | Solid | | color | White to off-white | | InChI | InChI=1/C10H14N5O6P.Na.H/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19;;/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19);;/t5-,6+,7+;;/s3 | | InChIKey | VLJHDKARANSOJK-BPETZYGMNA-N | | SMILES | NC1=NC=NC2N([C@H]3C[C@H](O)[C@@H](COP(O)(O)=O)O3)C=NC1=2.[NaH] |&1:7,9,11,r| | | CAS DataBase Reference | 2922-74-9(CAS DataBase Reference) |
| | 2'-Deoxyadenosine-5'-monophosphate disodium salt Usage And Synthesis |
| Description | 2'-Deoxyadenosine-5'-monophosphate disodium salt is a nucleic acid AMP derivative found in DNA. 2-Deoxyadenosine 5-monophosphate disodium can be used to study adenosine-based interactions during DNA synthesis and DNA damage. 2'-Deoxyadenosine-5'-monophosphate disodium salt reacts with chloride ions to form 2',3'-diacetylpyridine-5'-diphosphate dibasic chloride, which has been shown to inhibit bacterial growth and act as an antibacterial agent. | | Uses | 2′-Deoxyadenosine 5′-monophosphate disodium, a nucleic acid AMP derivative, is a deoxyribonucleotide found in DNA. 2′-Deoxyadenosine 5′-monophosphate disodium can be used to study adenosine-based interactions during DNA synthesis and DNA damage[1]. | | IC 50 | Microbial Metabolite; Human Endogenous Metabolite | | References | [1] Katsuya Narumi, et al. Mutual role of ecto-5'-nucleotidase/CD73 and concentrative nucleoside transporter 3 in the intestinal uptake of dAMP. PLoS One. 2019 Oct 21;14(10):e0223892. DOI:10.1371/journal.pone.0223892
[2] V Duarte, et al. Insertion of dGMP and dAMP during in vitro DNA synthesis opposite an oxidized form of 7,8-dihydro-8-oxoguanine. Nucleic Acids Res. 1999 Jan 15;27(2):496-502. DOI:10.1093/nar/27.2.496 |
| | 2'-Deoxyadenosine-5'-monophosphate disodium salt Preparation Products And Raw materials |
|