| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 2-Methyl-acrylic acid biphenyl-4-yl ester Basic information |
| Product Name: | 2-Methyl-acrylic acid biphenyl-4-yl ester | | Synonyms: | 2-METHYL-ACRYLIC;2-Propenoic acid, 2-methyl-, [1,1'-biphenyl]-4-yl ester;1,1'-biphenyl]-4-yl methacrylate;[1,1'-biphenyl]-4-yl 2-methylacrylate;1,1′-Biphenyl]-4-yl 2-methyl-2-propenoate;[1,1'-Biphenyl]-4-yl 2-methyl-2-propenoate;4-Biphenylyl methacrylate;[1,1'-Biphenyl]-4-yl methacrylate | | CAS: | 46904-74-9 | | MF: | C16H14O2 | | MW: | 238.28 | | EINECS: | | | Product Categories: | | | Mol File: | 46904-74-9.mol |  |
| | 2-Methyl-acrylic acid biphenyl-4-yl ester Chemical Properties |
| Melting point | 110 °C | | Boiling point | 378.3±12.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C16H14O2/c1-12(2)16(17)18-15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,1H2,2H3 | | InChIKey | HEJFLAMVALNBRR-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C2=CC=CC=C2)C=C1)(=O)C(C)=C |
| | 2-Methyl-acrylic acid biphenyl-4-yl ester Usage And Synthesis |
| Uses | 2-Methyl-acrylic Acid Biphenyl-4-yl Ester is an IR blocking filter. |
| | 2-Methyl-acrylic acid biphenyl-4-yl ester Preparation Products And Raw materials |
|