| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Norbornene-2-exo,3-exo-dimethanol Basic information |
| Product Name: | 5-Norbornene-2-exo,3-exo-dimethanol | | Synonyms: | BICYCLO[2.2.1]HEPT-5-ENE-2-EXO,3-EXO-DIMETHANOL;5-EXO,6-EXO-BIS(HYDROXYMETHYL)-2-NORBORNENE;Bicyclo[2.2.1]hept-5-ene-2-exo,3-exo-dimethanol
5-exo,6-exo-Bis(hydroxymethyl)-2-norbornene;5-Norbornene-2-exo,3-exo-dimethanol;5-Norbornene-2-exo,3-exo-dimethanol>;Bicyclo[2.2.1]hept-5-ene-2,3-dimethanol, (1R,2R,3S,4S)-rel-;[(1R,3S,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol;rel-(1R,2R,3S,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol | | CAS: | 699-95-6 | | MF: | C9H14O2 | | MW: | 154.21 | | EINECS: | | | Product Categories: | Alicyclic/Etch-Resistant Monomers;Lithography Monomers;Self Assembly&Contact Printing | | Mol File: | 699-95-6.mol |  |
| | 5-Norbornene-2-exo,3-exo-dimethanol Chemical Properties |
| Melting point | 53 °C | | Boiling point | 97 °C/20 mmHg(lit.) | | density | 1.027 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.523(lit.) | | Fp | 113 °C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.616±0.10(predicted) | | color | White to Almost white | | InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8+,9- | | InChIKey | IGHHPVIMEQGKNE-OJOKCITNSA-N | | SMILES | [H][C@]12C[C@]([H])(C=C1)[C@H](CO)[C@@H]2CO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2906190090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Norbornene-2-exo,3-exo-dimethanol Usage And Synthesis |
| Uses | 5-Norbornene-2-exo,3-exo-dimethanol can be used for various industrial coatings, such as anti-corrosion, protective, and adhesive coatings. |
| | 5-Norbornene-2-exo,3-exo-dimethanol Preparation Products And Raw materials |
|