|
|
| | Carbidopa impurity E Basic information |
| Product Name: | Carbidopa impurity E | | Synonyms: | Carbidopa impurity E;Carbidopa EP Impurity E;Carbidopa Impurity 5（Carbidopa EP Impurity E）;methyl (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate;(S)-methyl3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate;Carbidopa Impurity 5;(S)-Methyl 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate (Carbidopa Impurity);Benzenepropanoic acid, α-hydrazino-3,4-dihydroxy-α-methyl-, methyl ester, (S)- (9CI) | | CAS: | 52514-63-3 | | MF: | C11H16N2O4 | | MW: | 240.26 | | EINECS: | | | Product Categories: | | | Mol File: | 52514-63-3.mol |  |
| | Carbidopa impurity E Chemical Properties |
| Boiling point | 481.6±45.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 9.81±0.10(Predicted) | | color | Light Yellow to Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H16N2O4/c1-11(13-12,10(16)17-2)6-7-3-4-8(14)9(15)5-7/h3-5,13-15H,6,12H2,1-2H3/t11-/m0/s1 | | InChIKey | IETYBXLXKYRFEN-NSHDSACASA-N | | SMILES | C(OC)(=O)[C@](NN)(C)CC1=CC=C(O)C(O)=C1 |
| | Carbidopa impurity E Usage And Synthesis |
| Uses | (S)-Carbidopa Methyl Ester is an S-isomer prodrug of Carbidopa (C175915(M)), which is an inhibitor of aromatic amino acid decarboxylase. |
| | Carbidopa impurity E Preparation Products And Raw materials |
|